C55H41N3O4 — CID 136742144
(Z)-3-hydroxy-1-[6-[(Z)-3-hydroxy-3-[4-(N-phenylanilino)phenyl]prop-2-enoyl]-9-methylcarbazol-3-yl]-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one (PubChem CID 136742144) has the molecular formula C55H41N3O4 and a molecular weight of 807.95 g/mol. Its IUPAC name is (Z)-3-hydroxy-1-[6-[(Z)-3-hydroxy-3-[4-(N-phenylanilino)phenyl]prop-2-enoyl]-9-methylcarbazol-3-yl]-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-3-hydroxy-1-[6-[(Z)-3-hydroxy-3-[4-(N-phenylanilino)phenyl]prop-2-enoyl]-9-methylcarbazol-3-yl]-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 136742144 |
| Molecular Formula | C55H41N3O4 |
| Molecular Weight | 807.95 g/mol |
| Exact Mass | 807.31 |
| IUPAC Name | (Z)-3-hydroxy-1-[6-[(Z)-3-hydroxy-3-[4-(N-phenylanilino)phenyl]prop-2-enoyl]-9-methylcarbazol-3-yl]-3-[4-(N-phenylanilino)phenyl]prop-2-en-1-one |
| SMILES | Cn1c2ccc(C(=O)/C=C(\O)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2c2cc(C(=O)/C=C(\O)c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C55H41N3O4/c1-56-50-32-26-40(54(61)36-52(59)38-22-28-46(29-23-38)57(42-14-6-2-7-15-42)43-16-8-3-9-17-43)34-48(50)49-35-41(27-33-51(49)56)55(62)37-53(60)39-24-30-47(31-25-39)58(44-18-10-4-11-19-44)45-20-12-5-13-21-45/h2-37,59-60H,1H3/b52-36-,53-37- |
| InChIKey | RBQUYRGIZBNSEL-YAVJFOIKSA-N |
| XLogP | 13.83 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.95 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|