C30H25NO2 — CID 134598525
(Z)-4-methoxy-3-[4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one (PubChem CID 134598525) has the molecular formula C30H25NO2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (Z)-4-methoxy-3-[4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one.
| Compound Name | (Z)-4-methoxy-3-[4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 134598525 |
| Molecular Formula | C30H25NO2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (Z)-4-methoxy-3-[4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one |
| SMILES | CO/C(C)=C(\C(C)=O)c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25NO2/c1-20(32)30(21(2)33-3)23-15-13-22(14-16-23)24-17-18-29-27(19-24)26-11-7-8-12-28(26)31(29)25-9-5-4-6-10-25/h4-19H,1-3H3/b30-21+ |
| InChIKey | BFHGMGQTNJSQCS-MWAVMZGNSA-N |
| XLogP | 7.42 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|