C34H33NO2 — CID 134598526
(Z)-4-methoxy-3-[2,3,5,6-tetramethyl-4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one (PubChem CID 134598526) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is (Z)-4-methoxy-3-[2,3,5,6-tetramethyl-4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one.
| Compound Name | (Z)-4-methoxy-3-[2,3,5,6-tetramethyl-4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 134598526 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (Z)-4-methoxy-3-[2,3,5,6-tetramethyl-4-(9-phenylcarbazol-3-yl)phenyl]pent-3-en-2-one |
| SMILES | CO/C(C)=C(\C(C)=O)c1c(C)c(C)c(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C34H33NO2/c1-20-22(3)33(34(24(5)36)25(6)37-7)23(4)21(2)32(20)26-17-18-31-29(19-26)28-15-11-12-16-30(28)35(31)27-13-9-8-10-14-27/h8-19H,1-7H3/b34-25+ |
| InChIKey | BQJNKIXPBMUWBI-YQCHCMBFSA-N |
| XLogP | 8.65 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|