C24H20N2O5 — CID 2470136
[2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 2470136) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 2470136 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)COC(=O)c3ccc(C#N)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-15-12-21(16(2)26(15)20-10-8-18(9-11-20)23(28)30-3)22(27)14-31-24(29)19-6-4-17(13-25)5-7-19/h4-12H,14H2,1-3H3 |
| InChIKey | WSGHKLKRRCSREI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|