C22H21NO6 — CID 46822705
[2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylfuran-3-carboxylate (PubChem CID 46822705) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 46822705 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [2-[1-(4-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)COC(=O)c3ccoc3C)c2C)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-13-11-19(20(24)12-29-22(26)18-9-10-28-15(18)3)14(2)23(13)17-7-5-16(6-8-17)21(25)27-4/h5-11H,12H2,1-4H3 |
| InChIKey | ZQGJEQCGFMPBHW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|