C22H18N2O2 — CID 144963426
2-[4-(3,6-dimethoxycarbazol-9-yl)phenyl]ethynamine (PubChem CID 144963426) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[4-(3,6-dimethoxycarbazol-9-yl)phenyl]ethynamine.
| Compound Name | 2-[4-(3,6-dimethoxycarbazol-9-yl)phenyl]ethynamine |
|---|---|
| PubChem CID | 144963426 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[4-(3,6-dimethoxycarbazol-9-yl)phenyl]ethynamine |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(C#CN)cc1 |
| InChI | InChI=1S/C22H18N2O2/c1-25-17-7-9-21-19(13-17)20-14-18(26-2)8-10-22(20)24(21)16-5-3-15(4-6-16)11-12-23/h3-10,13-14H,23H2,1-2H3 |
| InChIKey | ZKIIRNXWTVCBEG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|