C59H41N3O5 — CID 148796534
9-(4-formylphenyl)-6-[6-[6-methoxy-9-(4-methoxyphenyl)carbazol-3-yl]-9-(4-methoxyphenyl)carbazol-3-yl]carbazole-3-carbaldehyde (PubChem CID 148796534) has the molecular formula C59H41N3O5 and a molecular weight of 871.99 g/mol. Its IUPAC name is 9-(4-formylphenyl)-6-[6-[6-methoxy-9-(4-methoxyphenyl)carbazol-3-yl]-9-(4-methoxyphenyl)carbazol-3-yl]carbazole-3-carbaldehyde.
| Compound Name | 9-(4-formylphenyl)-6-[6-[6-methoxy-9-(4-methoxyphenyl)carbazol-3-yl]-9-(4-methoxyphenyl)carbazol-3-yl]carbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 148796534 |
| Molecular Formula | C59H41N3O5 |
| Molecular Weight | 871.99 g/mol |
| Exact Mass | 871.30 |
| IUPAC Name | 9-(4-formylphenyl)-6-[6-[6-methoxy-9-(4-methoxyphenyl)carbazol-3-yl]-9-(4-methoxyphenyl)carbazol-3-yl]carbazole-3-carbaldehyde |
| SMILES | COc1ccc(-n2c3ccc(OC)cc3c3cc(-c4ccc5c(c4)c4cc(-c6ccc7c(c6)c6cc(C=O)ccc6n7-c6ccc(C=O)cc6)ccc4n5-c4ccc(OC)cc4)ccc32)cc1 |
| InChI | InChI=1S/C59H41N3O5/c1-65-45-17-13-43(14-18-45)61-56-24-8-39(38-7-23-55-49(29-38)48-28-37(35-64)6-22-54(48)60(55)42-11-4-36(34-63)5-12-42)30-50(56)51-31-40(9-25-57(51)61)41-10-26-58-52(32-41)53-33-47(67-3)21-27-59(53)62(58)44-15-19-46(66-2)20-16-44/h4-35H,1-3H3 |
| InChIKey | ONEWUZXXDISALC-UHFFFAOYSA-N |
| XLogP | 13.96 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.99 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|