C40H31NO4S — CID 130339144
9-[4-[(E)-2-[4-[4-(benzenesulfonyl)phenyl]phenyl]ethenyl]phenyl]-3,6-dimethoxycarbazole (PubChem CID 130339144) has the molecular formula C40H31NO4S and a molecular weight of 621.76 g/mol. Its IUPAC name is 9-[4-[(E)-2-[4-[4-(benzenesulfonyl)phenyl]phenyl]ethenyl]phenyl]-3,6-dimethoxycarbazole.
| Compound Name | 9-[4-[(E)-2-[4-[4-(benzenesulfonyl)phenyl]phenyl]ethenyl]phenyl]-3,6-dimethoxycarbazole |
|---|---|
| PubChem CID | 130339144 |
| Molecular Formula | C40H31NO4S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 9-[4-[(E)-2-[4-[4-(benzenesulfonyl)phenyl]phenyl]ethenyl]phenyl]-3,6-dimethoxycarbazole |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(/C=C/c2ccc(-c3ccc(S(=O)(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H31NO4S/c1-44-33-20-24-39-37(26-33)38-27-34(45-2)21-25-40(38)41(39)32-18-12-29(13-19-32)9-8-28-10-14-30(15-11-28)31-16-22-36(23-17-31)46(42,43)35-6-4-3-5-7-35/h3-27H,1-2H3/b9-8+ |
| InChIKey | WMLDOKRAKAHDKQ-CMDGGOBGSA-N |
| XLogP | 9.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|