C74H56N4O6 — CID 122429682
4-[4-[tris[4-(3,6-dimethoxycarbazol-9-yl)phenyl]methyl]phenyl]benzonitrile (PubChem CID 122429682) has the molecular formula C74H56N4O6 and a molecular weight of 1097.28 g/mol. Its IUPAC name is 4-[4-[tris[4-(3,6-dimethoxycarbazol-9-yl)phenyl]methyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[tris[4-(3,6-dimethoxycarbazol-9-yl)phenyl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 122429682 |
| Molecular Formula | C74H56N4O6 |
| Molecular Weight | 1097.28 g/mol |
| Exact Mass | 1096.42 |
| IUPAC Name | 4-[4-[tris[4-(3,6-dimethoxycarbazol-9-yl)phenyl]methyl]phenyl]benzonitrile |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(C(c2ccc(-c3ccc(C#N)cc3)cc2)(c2ccc(-n3c4ccc(OC)cc4c4cc(OC)ccc43)cc2)c2ccc(-n3c4ccc(OC)cc4c4cc(OC)ccc43)cc2)cc1 |
| InChI | InChI=1S/C74H56N4O6/c1-79-56-27-33-68-62(39-56)63-40-57(80-2)28-34-69(63)76(68)53-21-15-50(16-22-53)74(49-13-11-48(12-14-49)47-9-7-46(45-75)8-10-47,51-17-23-54(24-18-51)77-70-35-29-58(81-3)41-64(70)65-42-59(82-4)30-36-71(65)77)52-19-25-55(26-20-52)78-72-37-31-60(83-5)43-66(72)67-44-61(84-6)32-38-73(67)78/h7-44H,1-6H3 |
| InChIKey | OKGZBOSUYFQPEQ-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 93.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.28 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|