C68H62N4 — CID 89064691
4-[10-(4-cyanophenyl)-2,6-bis(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]benzonitrile (PubChem CID 89064691) has the molecular formula C68H62N4 and a molecular weight of 935.27 g/mol. Its IUPAC name is 4-[10-(4-cyanophenyl)-2,6-bis(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]benzonitrile.
| Compound Name | 4-[10-(4-cyanophenyl)-2,6-bis(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]benzonitrile |
|---|---|
| PubChem CID | 89064691 |
| Molecular Formula | C68H62N4 |
| Molecular Weight | 935.27 g/mol |
| Exact Mass | 934.50 |
| IUPAC Name | 4-[10-(4-cyanophenyl)-2,6-bis(3,6-ditert-butylcarbazol-9-yl)anthracen-9-yl]benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc2c(-c3ccc(C#N)cc3)c3cc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)ccc3c(-c3ccc(C#N)cc3)c2c1 |
| InChI | InChI=1S/C68H62N4/c1-65(2,3)45-21-29-59-53(33-45)54-34-46(66(4,5)6)22-30-60(54)71(59)49-25-27-51-57(37-49)63(43-17-13-41(39-69)14-18-43)52-28-26-50(38-58(52)64(51)44-19-15-42(40-70)16-20-44)72-61-31-23-47(67(7,8)9)35-55(61)56-36-48(68(10,11)12)24-32-62(56)72/h13-38H,1-12H3 |
| InChIKey | GGWZXUQBAYEPNL-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.27 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|