C57H29F5N6 — CID 89064680
9-[6-(3,6-dicyanocarbazol-9-yl)-10-[4-(1,1-difluoroethyl)phenyl]-9-[4-(trifluoromethyl)phenyl]anthracen-2-yl]carbazole-3,6-dicarbonitrile (PubChem CID 89064680) has the molecular formula C57H29F5N6 and a molecular weight of 892.89 g/mol. Its IUPAC name is 9-[6-(3,6-dicyanocarbazol-9-yl)-10-[4-(1,1-difluoroethyl)phenyl]-9-[4-(trifluoromethyl)phenyl]anthracen-2-yl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[6-(3,6-dicyanocarbazol-9-yl)-10-[4-(1,1-difluoroethyl)phenyl]-9-[4-(trifluoromethyl)phenyl]anthracen-2-yl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 89064680 |
| Molecular Formula | C57H29F5N6 |
| Molecular Weight | 892.89 g/mol |
| Exact Mass | 892.24 |
| IUPAC Name | 9-[6-(3,6-dicyanocarbazol-9-yl)-10-[4-(1,1-difluoroethyl)phenyl]-9-[4-(trifluoromethyl)phenyl]anthracen-2-yl]carbazole-3,6-dicarbonitrile |
| SMILES | CC(F)(F)c1ccc(-c2c3ccc(-n4c5ccc(C#N)cc5c5cc(C#N)ccc54)cc3c(-c3ccc(C(F)(F)F)cc3)c3ccc(-n4c5ccc(C#N)cc5c5cc(C#N)ccc54)cc23)cc1 |
| InChI | InChI=1S/C57H29F5N6/c1-56(58,59)38-10-6-36(7-11-38)54-42-16-14-41(68-52-20-4-34(30-65)24-46(52)47-25-35(31-66)5-21-53(47)68)27-49(42)55(37-8-12-39(13-9-37)57(60,61)62)43-17-15-40(26-48(43)54)67-50-18-2-32(28-63)22-44(50)45-23-33(29-64)3-19-51(45)67/h2-27H,1H3 |
| InChIKey | BBRCCOFBIGTGBD-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.89 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|