C46H31N5O2 — CID 154990024
4-(N-[3-carbazol-9-yl-5-(3,6-dimethoxycarbazol-9-yl)phenyl]-4-cyanoanilino)benzonitrile (PubChem CID 154990024) has the molecular formula C46H31N5O2 and a molecular weight of 685.79 g/mol. Its IUPAC name is 4-(N-[3-carbazol-9-yl-5-(3,6-dimethoxycarbazol-9-yl)phenyl]-4-cyanoanilino)benzonitrile.
| Compound Name | 4-(N-[3-carbazol-9-yl-5-(3,6-dimethoxycarbazol-9-yl)phenyl]-4-cyanoanilino)benzonitrile |
|---|---|
| PubChem CID | 154990024 |
| Molecular Formula | C46H31N5O2 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | 4-(N-[3-carbazol-9-yl-5-(3,6-dimethoxycarbazol-9-yl)phenyl]-4-cyanoanilino)benzonitrile |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1cc(N(c2ccc(C#N)cc2)c2ccc(C#N)cc2)cc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C46H31N5O2/c1-52-37-19-21-45-41(26-37)42-27-38(53-2)20-22-46(42)51(45)36-24-34(49(32-15-11-30(28-47)12-16-32)33-17-13-31(29-48)14-18-33)23-35(25-36)50-43-9-5-3-7-39(43)40-8-4-6-10-44(40)50/h3-27H,1-2H3 |
| InChIKey | CWESOAAXRZELJZ-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 79.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |