C26H22NO5P — CID 177244570
[3-[3-(2,7-dimethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid (PubChem CID 177244570) has the molecular formula C26H22NO5P and a molecular weight of 459.44 g/mol. Its IUPAC name is [3-[3-(2,7-dimethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid.
| Compound Name | [3-[3-(2,7-dimethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 177244570 |
| Molecular Formula | C26H22NO5P |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [3-[3-(2,7-dimethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid |
| SMILES | COc1ccc2c3ccc(OC)cc3n(-c3cccc(-c4cccc(P(=O)(O)O)c4)c3)c2c1 |
| InChI | InChI=1S/C26H22NO5P/c1-31-20-9-11-23-24-12-10-21(32-2)16-26(24)27(25(23)15-20)19-7-3-5-17(13-19)18-6-4-8-22(14-18)33(28,29)30/h3-16H,1-2H3,(H2,28,29,30) |
| InChIKey | SHWHXGHBAATGPV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|