C24H16Br2NO3P — CID 177244586
[3-[4-(2,7-dibromocarbazol-9-yl)phenyl]phenyl]phosphonic acid (PubChem CID 177244586) has the molecular formula C24H16Br2NO3P and a molecular weight of 557.18 g/mol. Its IUPAC name is [3-[4-(2,7-dibromocarbazol-9-yl)phenyl]phenyl]phosphonic acid.
| Compound Name | [3-[4-(2,7-dibromocarbazol-9-yl)phenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 177244586 |
| Molecular Formula | C24H16Br2NO3P |
| Molecular Weight | 557.18 g/mol |
| Exact Mass | 554.92 |
| IUPAC Name | [3-[4-(2,7-dibromocarbazol-9-yl)phenyl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1cccc(-c2ccc(-n3c4cc(Br)ccc4c4ccc(Br)cc43)cc2)c1 |
| InChI | InChI=1S/C24H16Br2NO3P/c25-17-6-10-21-22-11-7-18(26)14-24(22)27(23(21)13-17)19-8-4-15(5-9-19)16-2-1-3-20(12-16)31(28,29)30/h1-14H,(H2,28,29,30) |
| InChIKey | PTTHSNAOGNWBMB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.18 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|