[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid

C26H22NO4P — CID 178181460

IUPAC[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid
SMILESCCOc1ccc2c3ccccc3n(-c3ccc(-c4ccc(P(=O)(O)O)cc4)cc3)c2c1
InChIInChI=1S/C26H22NO4P/c1-2-31-21-13-16-24-23-5-3-4-6-25(23)27(26(24)17-21)20-11-7-18(8-12-20)19-9-14-22(15-10-19)32(28,29)30/h3-17H,2H2,1H3,(H2,28,29,30)
InChIKeyMEAHDEAUWOFPMT-UHFFFAOYSA-N
MW443.44 g/mol
LogP5.65
Rot. Bonds5

About [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid

[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid (PubChem CID 178181460) has the molecular formula C26H22NO4P and a molecular weight of 443.44 g/mol. Its IUPAC name is [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid.

Molecular Properties

Compound Name[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid
PubChem CID178181460
Molecular FormulaC26H22NO4P
Molecular Weight443.44 g/mol
Exact Mass443.13
IUPAC Name[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid
SMILESCCOc1ccc2c3ccccc3n(-c3ccc(-c4ccc(P(=O)(O)O)cc4)cc3)c2c1
InChIInChI=1S/C26H22NO4P/c1-2-31-21-13-16-24-23-5-3-4-6-25(23)27(26(24)17-21)20-11-7-18(8-12-20)19-9-14-22(15-10-19)32(28,29)30/h3-17H,2H2,1H3,(H2,28,29,30)
InChIKeyMEAHDEAUWOFPMT-UHFFFAOYSA-N
XLogP5.65
TPSA71.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms32
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500443.44
LogP ≤ 55.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid?
The IUPAC name of [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid (CID 178181460) is [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid.
What is the SMILES notation for [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid?
The canonical SMILES for [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid is CCOc1ccc2c3ccccc3n(-c3ccc(-c4ccc(P(=O)(O)O)cc4)cc3)c2c1.
What is the InChIKey of [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid?
The InChIKey is MEAHDEAUWOFPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22NO4P/c1-2-31-21-13-16-24-23-5-3-4-6-25(23)27(26(24)17-21)20-11-7-18(8-12-20)19-9-14-22(15-10-19)32(28,29)30/h3-17H,2H2,1H3,(H2,28,29,30).
What are the key properties of [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid?
[4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid has a molecular weight of 443.44 g/mol, XLogP of 5.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(2-ethoxycarbazol-9-yl)phenyl]phenyl]phosphonic acid is sourced from PubChem (CID 178181460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).