C20H18NO3P — CID 177244403
[4-(2-ethylcarbazol-9-yl)phenyl]phosphonic acid (PubChem CID 177244403) has the molecular formula C20H18NO3P and a molecular weight of 351.34 g/mol. Its IUPAC name is [4-(2-ethylcarbazol-9-yl)phenyl]phosphonic acid.
| Compound Name | [4-(2-ethylcarbazol-9-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 177244403 |
| Molecular Formula | C20H18NO3P |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [4-(2-ethylcarbazol-9-yl)phenyl]phosphonic acid |
| SMILES | CCc1ccc2c3ccccc3n(-c3ccc(P(=O)(O)O)cc3)c2c1 |
| InChI | InChI=1S/C20H18NO3P/c1-2-14-7-12-18-17-5-3-4-6-19(17)21(20(18)13-14)15-8-10-16(11-9-15)25(22,23)24/h3-13H,2H2,1H3,(H2,22,23,24) |
| InChIKey | XAZOZBXCPWWOBU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|