4-(2,7-diethylcarbazol-9-yl)benzoic acid

C23H21NO2 — CID 139957754

IUPAC4-(2,7-diethylcarbazol-9-yl)benzoic acid
SMILESCCc1ccc2c3ccc(CC)cc3n(-c3ccc(C(=O)O)cc3)c2c1
InChIInChI=1S/C23H21NO2/c1-3-15-5-11-19-20-12-6-16(4-2)14-22(20)24(21(19)13-15)18-9-7-17(8-10-18)23(25)26/h5-14H,3-4H2,1-2H3,(H,25,26)
InChIKeyPTUGRRKNBLWSPK-UHFFFAOYSA-N
MW343.43 g/mol
LogP5.61
Rot. Bonds4

About 4-(2,7-diethylcarbazol-9-yl)benzoic acid

4-(2,7-diethylcarbazol-9-yl)benzoic acid (PubChem CID 139957754) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-(2,7-diethylcarbazol-9-yl)benzoic acid.

Molecular Properties

Compound Name4-(2,7-diethylcarbazol-9-yl)benzoic acid
PubChem CID139957754
Molecular FormulaC23H21NO2
Molecular Weight343.43 g/mol
Exact Mass343.16
IUPAC Name4-(2,7-diethylcarbazol-9-yl)benzoic acid
SMILESCCc1ccc2c3ccc(CC)cc3n(-c3ccc(C(=O)O)cc3)c2c1
InChIInChI=1S/C23H21NO2/c1-3-15-5-11-19-20-12-6-16(4-2)14-22(20)24(21(19)13-15)18-9-7-17(8-10-18)23(25)26/h5-14H,3-4H2,1-2H3,(H,25,26)
InChIKeyPTUGRRKNBLWSPK-UHFFFAOYSA-N
XLogP5.61
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500343.43
LogP ≤ 55.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(2,7-diethylcarbazol-9-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,7-diethylcarbazol-9-yl)benzoic acid?
The IUPAC name of 4-(2,7-diethylcarbazol-9-yl)benzoic acid (CID 139957754) is 4-(2,7-diethylcarbazol-9-yl)benzoic acid.
What is the SMILES notation for 4-(2,7-diethylcarbazol-9-yl)benzoic acid?
The canonical SMILES for 4-(2,7-diethylcarbazol-9-yl)benzoic acid is CCc1ccc2c3ccc(CC)cc3n(-c3ccc(C(=O)O)cc3)c2c1.
What is the InChIKey of 4-(2,7-diethylcarbazol-9-yl)benzoic acid?
The InChIKey is PTUGRRKNBLWSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO2/c1-3-15-5-11-19-20-12-6-16(4-2)14-22(20)24(21(19)13-15)18-9-7-17(8-10-18)23(25)26/h5-14H,3-4H2,1-2H3,(H,25,26).
What are the key properties of 4-(2,7-diethylcarbazol-9-yl)benzoic acid?
4-(2,7-diethylcarbazol-9-yl)benzoic acid has a molecular weight of 343.43 g/mol, XLogP of 5.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-diethylcarbazol-9-yl)benzoic acid is sourced from PubChem (CID 139957754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).