C20H16N2O3 — CID 91328246
4-[[7-(hydroxymethyl)pyrido[3,4-b]indol-9-yl]methyl]benzoic acid (PubChem CID 91328246) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[[7-(hydroxymethyl)pyrido[3,4-b]indol-9-yl]methyl]benzoic acid.
| Compound Name | 4-[[7-(hydroxymethyl)pyrido[3,4-b]indol-9-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 91328246 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[[7-(hydroxymethyl)pyrido[3,4-b]indol-9-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cn2c3cnccc3c3ccc(CO)cc32)cc1 |
| InChI | InChI=1S/C20H16N2O3/c23-12-14-3-6-16-17-7-8-21-10-19(17)22(18(16)9-14)11-13-1-4-15(5-2-13)20(24)25/h1-10,23H,11-12H2,(H,24,25) |
| InChIKey | NBQNTICXOPRWDR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |