C21H18ClN3O — CID 121363768
N-[(3-chlorophenyl)methyl]-9-ethylpyrido[3,4-b]indole-7-carboxamide (PubChem CID 121363768) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-9-ethylpyrido[3,4-b]indole-7-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-9-ethylpyrido[3,4-b]indole-7-carboxamide |
|---|---|
| PubChem CID | 121363768 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-9-ethylpyrido[3,4-b]indole-7-carboxamide |
| SMILES | CCn1c2cnccc2c2ccc(C(=O)NCc3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C21H18ClN3O/c1-2-25-19-11-15(6-7-17(19)18-8-9-23-13-20(18)25)21(26)24-12-14-4-3-5-16(22)10-14/h3-11,13H,2,12H2,1H3,(H,24,26) |
| InChIKey | ZUOQOICMRPWBMS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |