C15H11Cl2N3O — CID 59292119
4-chloro-N-[(3-chlorophenyl)methyl]-1H-indazole-6-carboxamide (PubChem CID 59292119) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorophenyl)methyl]-1H-indazole-6-carboxamide.
| Compound Name | 4-chloro-N-[(3-chlorophenyl)methyl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 59292119 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-chloro-N-[(3-chlorophenyl)methyl]-1H-indazole-6-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cc(Cl)c2cn[nH]c2c1 |
| InChI | InChI=1S/C15H11Cl2N3O/c16-11-3-1-2-9(4-11)7-18-15(21)10-5-13(17)12-8-19-20-14(12)6-10/h1-6,8H,7H2,(H,18,21)(H,19,20) |
| InChIKey | NJVIALSSLKZMBL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |