C15H10ClF2N3O — CID 137453536
3-chloro-4,5-difluoro-N-(1H-indazol-4-ylmethyl)benzamide (PubChem CID 137453536) has the molecular formula C15H10ClF2N3O and a molecular weight of 321.71 g/mol. Its IUPAC name is 3-chloro-4,5-difluoro-N-(1H-indazol-4-ylmethyl)benzamide.
| Compound Name | 3-chloro-4,5-difluoro-N-(1H-indazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 137453536 |
| Molecular Formula | C15H10ClF2N3O |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-chloro-4,5-difluoro-N-(1H-indazol-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccc2[nH]ncc12)c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C15H10ClF2N3O/c16-11-4-9(5-12(17)14(11)18)15(22)19-6-8-2-1-3-13-10(8)7-20-21-13/h1-5,7H,6H2,(H,19,22)(H,20,21) |
| InChIKey | XPJVNGBSGQTWNX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|