C27H20ClN3O — CID 46091822
N-[(3-chlorophenyl)methyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 46091822) has the molecular formula C27H20ClN3O and a molecular weight of 437.93 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 46091822 |
| Molecular Formula | C27H20ClN3O |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1ccc(-c2cc(-c3cccc4ccccc34)[nH]n2)cc1 |
| InChI | InChI=1S/C27H20ClN3O/c28-22-8-3-5-18(15-22)17-29-27(32)21-13-11-20(12-14-21)25-16-26(31-30-25)24-10-4-7-19-6-1-2-9-23(19)24/h1-16H,17H2,(H,29,32)(H,30,31) |
| InChIKey | AINPDJFUKALGQN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |