C25H21Cl2N3O2 — CID 46091871
4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-[(2-ethoxyphenyl)methyl]benzamide (PubChem CID 46091871) has the molecular formula C25H21Cl2N3O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-[(2-ethoxyphenyl)methyl]benzamide.
| Compound Name | 4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-[(2-ethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46091871 |
| Molecular Formula | C25H21Cl2N3O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-[(2-ethoxyphenyl)methyl]benzamide |
| SMILES | CCOc1ccccc1CNC(=O)c1ccc(-c2cc(-c3ccc(Cl)cc3Cl)[nH]n2)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O2/c1-2-32-24-6-4-3-5-18(24)15-28-25(31)17-9-7-16(8-10-17)22-14-23(30-29-22)20-12-11-19(26)13-21(20)27/h3-14H,2,15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | OXDVDNHOWHXUMU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |