C20H17Cl2N3O — CID 46092129
N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide (PubChem CID 46092129) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide.
| Compound Name | N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 46092129 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide |
| SMILES | O=C(NC1CCC1)c1ccc(-c2cc(-c3ccc(Cl)cc3Cl)[nH]n2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-14-8-9-16(17(22)10-14)19-11-18(24-25-19)12-4-6-13(7-5-12)20(26)23-15-2-1-3-15/h4-11,15H,1-3H2,(H,23,26)(H,24,25) |
| InChIKey | KYLZVQRVANJZIT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |