About N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide
N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide (PubChem CID 46092129) has the molecular formula C20H17Cl2N3O
and a molecular weight of 386.28 g/mol. Its IUPAC name is N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide.
Molecular Properties
| Compound Name | N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide |
| PubChem CID | 46092129 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide |
| SMILES | O=C(NC1CCC1)c1ccc(-c2cc(-c3ccc(Cl)cc3Cl)[nH]n2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-14-8-9-16(17(22)10-14)19-11-18(24-25-19)12-4-6-13(7-5-12)20(26)23-15-2-1-3-15/h4-11,15H,1-3H2,(H,23,26)(H,24,25) |
| InChIKey | KYLZVQRVANJZIT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide?
The IUPAC name of N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide (CID 46092129) is N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide.
What is the SMILES notation for N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide?
The canonical SMILES for N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide is O=C(NC1CCC1)c1ccc(-c2cc(-c3ccc(Cl)cc3Cl)[nH]n2)cc1.
What is the InChIKey of N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide?
The InChIKey is KYLZVQRVANJZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2N3O/c21-14-8-9-16(17(22)10-14)19-11-18(24-25-19)12-4-6-13(7-5-12)20(26)23-15-2-1-3-15/h4-11,15H,1-3H2,(H,23,26)(H,24,25).
What are the key properties of N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide?
N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide has a molecular weight of 386.28 g/mol, XLogP of 5.33, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-4-[5-(2,4-dichlorophenyl)-1H-pyrazol-3-yl]benzamide is sourced from PubChem (CID 46092129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).