C24H20ClN3O — CID 46091915
N-[(2-chloro-6-methylphenyl)methyl]-4-(3-phenyl-1H-pyrazol-5-yl)benzamide (PubChem CID 46091915) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is N-[(2-chloro-6-methylphenyl)methyl]-4-(3-phenyl-1H-pyrazol-5-yl)benzamide.
| Compound Name | N-[(2-chloro-6-methylphenyl)methyl]-4-(3-phenyl-1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 46091915 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(2-chloro-6-methylphenyl)methyl]-4-(3-phenyl-1H-pyrazol-5-yl)benzamide |
| SMILES | Cc1cccc(Cl)c1CNC(=O)c1ccc(-c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C24H20ClN3O/c1-16-6-5-9-21(25)20(16)15-26-24(29)19-12-10-18(11-13-19)23-14-22(27-28-23)17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | PBWFQVTUTLYGGR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |