C28H23N3O — CID 92819649
4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 92819649) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 92819649 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(-c2cc(-c3cccc4ccccc34)[nH]n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O/c1-19(20-8-3-2-4-9-20)29-28(32)23-16-14-22(15-17-23)26-18-27(31-30-26)25-13-7-11-21-10-5-6-12-24(21)25/h2-19H,1H3,(H,29,32)(H,30,31)/t19-/m0/s1 |
| InChIKey | IVBLVNCDKNTWFH-IBGZPJMESA-N |
| XLogP | 6.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |