C29H25N3O2 — CID 46091971
N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide (PubChem CID 46091971) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide.
| Compound Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 46091971 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-4-(5-naphthalen-1-yl-1H-pyrazol-3-yl)benzamide |
| SMILES | COc1cccc([C@@H](C)NC(=O)c2ccc(-c3cc(-c4cccc5ccccc45)[nH]n3)cc2)c1 |
| InChI | InChI=1S/C29H25N3O2/c1-19(23-9-5-10-24(17-23)34-2)30-29(33)22-15-13-21(14-16-22)27-18-28(32-31-27)26-12-6-8-20-7-3-4-11-25(20)26/h3-19H,1-2H3,(H,30,33)(H,31,32)/t19-/m1/s1 |
| InChIKey | BDPRXOVDPHACST-LJQANCHMSA-N |
| XLogP | 6.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |