C23H24N2O2 — CID 68511029
4-(2,6-dimethyl-4-pyridinyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 68511029) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 68511029 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1cccc([C@@H](C)NC(=O)c2ccc(-c3cc(C)nc(C)c3)cc2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-15-12-21(13-16(2)24-15)18-8-10-19(11-9-18)23(26)25-17(3)20-6-5-7-22(14-20)27-4/h5-14,17H,1-4H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | WBQCULFFYOARKU-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |