C18H13ClN2 — CID 141321511
9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole (PubChem CID 141321511) has the molecular formula C18H13ClN2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole.
| Compound Name | 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 141321511 |
| Molecular Formula | C18H13ClN2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 9-[(3-chlorophenyl)methyl]pyrido[3,4-b]indole |
| SMILES | Clc1cccc(Cn2c3ccccc3c3ccncc32)c1 |
| InChI | InChI=1S/C18H13ClN2/c19-14-5-3-4-13(10-14)12-21-17-7-2-1-6-15(17)16-8-9-20-11-18(16)21/h1-11H,12H2 |
| InChIKey | FVJXBRISEWBDII-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |