C19H16N2 — CID 162417840
9-(2-phenylethyl)pyrido[3,4-b]indole (PubChem CID 162417840) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 9-(2-phenylethyl)pyrido[3,4-b]indole.
| Compound Name | 9-(2-phenylethyl)pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 162417840 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 9-(2-phenylethyl)pyrido[3,4-b]indole |
| SMILES | c1ccc(CCn2c3ccccc3c3ccncc32)cc1 |
| InChI | InChI=1S/C19H16N2/c1-2-6-15(7-3-1)11-13-21-18-9-5-4-8-16(18)17-10-12-20-14-19(17)21/h1-10,12,14H,11,13H2 |
| InChIKey | MCPRSRMRWSYGJU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |