C21H19N3O2 — CID 139211454
3-[(2-pyrido[3,4-b]indol-9-ylethylamino)methyl]benzoic acid (PubChem CID 139211454) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[(2-pyrido[3,4-b]indol-9-ylethylamino)methyl]benzoic acid.
| Compound Name | 3-[(2-pyrido[3,4-b]indol-9-ylethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 139211454 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[(2-pyrido[3,4-b]indol-9-ylethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNCCn2c3ccccc3c3ccncc32)c1 |
| InChI | InChI=1S/C21H19N3O2/c25-21(26)16-5-3-4-15(12-16)13-23-10-11-24-19-7-2-1-6-17(19)18-8-9-22-14-20(18)24/h1-9,12,14,23H,10-11,13H2,(H,25,26) |
| InChIKey | XWDNEFSGELXBCJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|