C17H20ClN5 — CID 944862
8-chloro-N-(2-piperidin-1-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 944862) has the molecular formula C17H20ClN5 and a molecular weight of 329.83 g/mol. Its IUPAC name is 8-chloro-N-(2-piperidin-1-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | 8-chloro-N-(2-piperidin-1-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 944862 |
| Molecular Formula | C17H20ClN5 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 8-chloro-N-(2-piperidin-1-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | Clc1ccc2[nH]c3c(NCCN4CCCCC4)ncnc3c2c1 |
| InChI | InChI=1S/C17H20ClN5/c18-12-4-5-14-13(10-12)15-16(22-14)17(21-11-20-15)19-6-9-23-7-2-1-3-8-23/h4-5,10-11,22H,1-3,6-9H2,(H,19,20,21) |
| InChIKey | RKAJNBBFDRNMHH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |