C12H11FN4O — CID 2005544
2-[(8-fluoro-5H-pyrimido[5,4-b]indol-4-yl)amino]ethanol (PubChem CID 2005544) has the molecular formula C12H11FN4O and a molecular weight of 246.24 g/mol. Its IUPAC name is 2-[(8-fluoro-5H-pyrimido[5,4-b]indol-4-yl)amino]ethanol.
| Compound Name | 2-[(8-fluoro-5H-pyrimido[5,4-b]indol-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 2005544 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[(8-fluoro-5H-pyrimido[5,4-b]indol-4-yl)amino]ethanol |
| SMILES | OCCNc1ncnc2c1[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C12H11FN4O/c13-7-1-2-9-8(5-7)10-11(17-9)12(14-3-4-18)16-6-15-10/h1-2,5-6,17-18H,3-4H2,(H,14,15,16) |
| InChIKey | WILZZOKTRRSCPG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |