C18H24N5O2+ — CID 7688906
8-ethoxy-N-(2-morpholin-4-ium-4-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 7688906) has the molecular formula C18H24N5O2+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 8-ethoxy-N-(2-morpholin-4-ium-4-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | 8-ethoxy-N-(2-morpholin-4-ium-4-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 7688906 |
| Molecular Formula | C18H24N5O2+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 8-ethoxy-N-(2-morpholin-4-ium-4-ylethyl)-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | CCOc1ccc2[nH]c3c(NCC[NH+]4CCOCC4)ncnc3c2c1 |
| InChI | InChI=1S/C18H23N5O2/c1-2-25-13-3-4-15-14(11-13)16-17(22-15)18(21-12-20-16)19-5-6-23-7-9-24-10-8-23/h3-4,11-12,22H,2,5-10H2,1H3,(H,19,20,21)/p+1 |
| InChIKey | LUEDRBMIVMAZLS-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |