C20H24N4O — CID 939062
N-[2-(cyclohexen-1-yl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 939062) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 939062 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | CCOc1ccc2[nH]c3c(NCCC4=CCCCC4)ncnc3c2c1 |
| InChI | InChI=1S/C20H24N4O/c1-2-25-15-8-9-17-16(12-15)18-19(24-17)20(23-13-22-18)21-11-10-14-6-4-3-5-7-14/h6,8-9,12-13,24H,2-5,7,10-11H2,1H3,(H,21,22,23) |
| InChIKey | WCUQVQUPGJPBCE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|