C20H23N5 — CID 143571535
4-N-tert-butyl-5-(2-naphthalen-1-ylethanimidoyl)pyrimidine-4,6-diamine (PubChem CID 143571535) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-N-tert-butyl-5-(2-naphthalen-1-ylethanimidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-tert-butyl-5-(2-naphthalen-1-ylethanimidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143571535 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 4-N-tert-butyl-5-(2-naphthalen-1-ylethanimidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(/Cc1cccc2ccccc12)c1c(N)ncnc1NC(C)(C)C |
| InChI | InChI=1S/C20H23N5/c1-20(2,3)25-19-17(18(22)23-12-24-19)16(21)11-14-9-6-8-13-7-4-5-10-15(13)14/h4-10,12,21H,11H2,1-3H3,(H3,22,23,24,25)/b21-16- |
| InChIKey | GJUAZSVVJHDJOW-PGMHBOJBSA-N |
| XLogP | 4.03 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|