C21H20F3N7O — CID 143978753
1-[4-[2-[4-amino-6-(methylamino)pyrimidin-5-yl]-2-iminoethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 143978753) has the molecular formula C21H20F3N7O and a molecular weight of 443.43 g/mol. Its IUPAC name is 1-[4-[2-[4-amino-6-(methylamino)pyrimidin-5-yl]-2-iminoethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[2-[4-amino-6-(methylamino)pyrimidin-5-yl]-2-iminoethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 143978753 |
| Molecular Formula | C21H20F3N7O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[4-[2-[4-amino-6-(methylamino)pyrimidin-5-yl]-2-iminoethyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | [H]/N=C(\Cc1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1c(N)ncnc1NC |
| InChI | InChI=1S/C21H20F3N7O/c1-27-19-17(18(26)28-11-29-19)16(25)9-12-5-7-14(8-6-12)30-20(32)31-15-4-2-3-13(10-15)21(22,23)24/h2-8,10-11,25H,9H2,1H3,(H2,30,31,32)(H3,26,27,28,29)/b25-16+ |
| InChIKey | MYGLLGSHURPCSW-PCLIKHOPSA-N |
| XLogP | 4.37 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|