C21H16F3N5O — CID 69158745
N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 69158745) has the molecular formula C21H16F3N5O and a molecular weight of 411.39 g/mol. Its IUPAC name is N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 69158745 |
| Molecular Formula | C21H16F3N5O |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nc1ncnc(N)c1C#Cc1cccc(NC(=O)Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H16F3N5O/c22-21(23,24)15-7-4-14(5-8-15)11-18(30)29-16-3-1-2-13(10-16)6-9-17-19(25)27-12-28-20(17)26/h1-5,7-8,10,12H,11H2,(H,29,30)(H4,25,26,27,28) |
| InChIKey | XXYSCRDEVSWVBF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|