C18H15N5O2S — CID 59744301
N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]benzenesulfonamide (PubChem CID 59744301) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59744301 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]benzenesulfonamide |
| SMILES | Nc1ncnc(N)c1C#Cc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H15N5O2S/c19-17-16(18(20)22-12-21-17)10-9-13-5-4-6-14(11-13)23-26(24,25)15-7-2-1-3-8-15/h1-8,11-12,23H,(H4,19,20,21,22) |
| InChIKey | WYJBPPLRGXBBMI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|