C17H15NO2S — CID 170620107
N-[3-[(Z)-pent-3-en-1-ynyl]phenyl]benzenesulfonamide (PubChem CID 170620107) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[3-[(Z)-pent-3-en-1-ynyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(Z)-pent-3-en-1-ynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 170620107 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[3-[(Z)-pent-3-en-1-ynyl]phenyl]benzenesulfonamide |
| SMILES | C/C=C\C#Cc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H15NO2S/c1-2-3-5-9-15-10-8-11-16(14-15)18-21(19,20)17-12-6-4-7-13-17/h2-4,6-8,10-14,18H,1H3/b3-2- |
| InChIKey | DSFSVZGUECSLPF-IHWYPQMZSA-N |
| XLogP | 3.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|