C17H12N2O6S — CID 10690638
(E)-5-[3-[(4-nitrophenyl)sulfonylamino]phenyl]pent-2-en-4-ynoic acid (PubChem CID 10690638) has the molecular formula C17H12N2O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is (E)-5-[3-[(4-nitrophenyl)sulfonylamino]phenyl]pent-2-en-4-ynoic acid.
| Compound Name | (E)-5-[3-[(4-nitrophenyl)sulfonylamino]phenyl]pent-2-en-4-ynoic acid |
|---|---|
| PubChem CID | 10690638 |
| Molecular Formula | C17H12N2O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (E)-5-[3-[(4-nitrophenyl)sulfonylamino]phenyl]pent-2-en-4-ynoic acid |
| SMILES | O=C(O)/C=C/C#Cc1cccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H12N2O6S/c20-17(21)7-2-1-4-13-5-3-6-14(12-13)18-26(24,25)16-10-8-15(9-11-16)19(22)23/h2-3,5-12,18H,(H,20,21)/b7-2+ |
| InChIKey | QELSEMLUOLKMIU-FARCUNLSSA-N |
| XLogP | 2.39 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|