C18H14FN5O2S — CID 59744298
N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-fluorobenzenesulfonamide (PubChem CID 59744298) has the molecular formula C18H14FN5O2S and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59744298 |
| Molecular Formula | C18H14FN5O2S |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-fluorobenzenesulfonamide |
| SMILES | Nc1ncnc(N)c1C#Cc1cccc(NS(=O)(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H14FN5O2S/c19-13-4-2-6-15(10-13)27(25,26)24-14-5-1-3-12(9-14)7-8-16-17(20)22-11-23-18(16)21/h1-6,9-11,24H,(H4,20,21,22,23) |
| InChIKey | JXNZCSAXWCOPTM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|