C31H27N11O — CID 69371953
5-[2-(3-aminophenyl)ethynyl]pyrimidine-4,6-diamine;1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-phenylurea (PubChem CID 69371953) has the molecular formula C31H27N11O and a molecular weight of 569.63 g/mol. Its IUPAC name is 5-[2-(3-aminophenyl)ethynyl]pyrimidine-4,6-diamine;1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-phenylurea.
| Compound Name | 5-[2-(3-aminophenyl)ethynyl]pyrimidine-4,6-diamine;1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 69371953 |
| Molecular Formula | C31H27N11O |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 5-[2-(3-aminophenyl)ethynyl]pyrimidine-4,6-diamine;1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-3-phenylurea |
| SMILES | Nc1cccc(C#Cc2c(N)ncnc2N)c1.Nc1ncnc(N)c1C#Cc1cccc(NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H16N6O.C12H11N5/c20-17-16(18(21)23-12-22-17)10-9-13-5-4-8-15(11-13)25-19(26)24-14-6-2-1-3-7-14;13-9-3-1-2-8(6-9)4-5-10-11(14)16-7-17-12(10)15/h1-8,11-12H,(H2,24,25,26)(H4,20,21,22,23);1-3,6-7H,13H2,(H4,14,15,16,17) |
| InChIKey | HSJDGRLVVWFDIK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 222.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|