C19H15N5O2 — CID 69159182
[4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-phenylcarbamic acid (PubChem CID 69159182) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is [4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-phenylcarbamic acid.
| Compound Name | [4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 69159182 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-phenylcarbamic acid |
| SMILES | Nc1ncnc(N)c1C#Cc1ccc(N(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15N5O2/c20-17-16(18(21)23-12-22-17)11-8-13-6-9-15(10-7-13)24(19(25)26)14-4-2-1-3-5-14/h1-7,9-10,12H,(H,25,26)(H4,20,21,22,23) |
| InChIKey | WODWTMCBFSYJOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|