C20H14F4N6O — CID 174501306
1-[4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 174501306) has the molecular formula C20H14F4N6O and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-[4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 174501306 |
| Molecular Formula | C20H14F4N6O |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[4-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)N(c1ccc(C#Cc2c(N)ncnc2N)cc1)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C20H14F4N6O/c21-15-8-4-12(20(22,23)24)9-16(15)30(19(27)31)13-5-1-11(2-6-13)3-7-14-17(25)28-10-29-18(14)26/h1-2,4-6,8-10H,(H2,27,31)(H4,25,26,28,29) |
| InChIKey | XADYNJMSYVXQKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|