C17H10F4N6OS — CID 11350706
1-[5-[2-(2-aminopyrimidin-5-yl)ethynyl]-1,3-thiazol-2-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 11350706) has the molecular formula C17H10F4N6OS and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-[5-[2-(2-aminopyrimidin-5-yl)ethynyl]-1,3-thiazol-2-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[2-(2-aminopyrimidin-5-yl)ethynyl]-1,3-thiazol-2-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11350706 |
| Molecular Formula | C17H10F4N6OS |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-[5-[2-(2-aminopyrimidin-5-yl)ethynyl]-1,3-thiazol-2-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1ncc(C#Cc2cnc(NC(=O)Nc3cc(C(F)(F)F)ccc3F)s2)cn1 |
| InChI | InChI=1S/C17H10F4N6OS/c18-12-4-2-10(17(19,20)21)5-13(12)26-15(28)27-16-25-8-11(29-16)3-1-9-6-23-14(22)24-7-9/h2,4-8H,(H2,22,23,24)(H2,25,26,27,28) |
| InChIKey | ZBIGWGDJCDJCOI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|