C18H10F4N4OS — CID 11668610
5-[2-(2-aminopyrimidin-5-yl)ethynyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 11668610) has the molecular formula C18H10F4N4OS and a molecular weight of 406.36 g/mol. Its IUPAC name is 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11668610 |
| Molecular Formula | C18H10F4N4OS |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | Nc1ncc(C#Cc2ccc(C(=O)Nc3cc(C(F)(F)F)ccc3F)s2)cn1 |
| InChI | InChI=1S/C18H10F4N4OS/c19-13-5-2-11(18(20,21)22)7-14(13)26-16(27)15-6-4-12(28-15)3-1-10-8-24-17(23)25-9-10/h2,4-9H,(H,26,27)(H2,23,24,25) |
| InChIKey | GEBPSLZDSOGJHH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|