C12H10F4N4O — CID 115330823
5-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 115330823) has the molecular formula C12H10F4N4O and a molecular weight of 302.23 g/mol. Its IUPAC name is 5-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115330823 |
| Molecular Formula | C12H10F4N4O |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2cc(C(F)(F)F)ccc2F)c1N |
| InChI | InChI=1S/C12H10F4N4O/c1-20-10(17)7(5-18-20)11(21)19-9-4-6(12(14,15)16)2-3-8(9)13/h2-5H,17H2,1H3,(H,19,21) |
| InChIKey | DVGJWTINHMXGIC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |