C18H14F4N2O3 — CID 174915783
1-N'-[2-fluoro-5-(trifluoromethyl)phenyl]-1-N'-(4-hydroxyphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 174915783) has the molecular formula C18H14F4N2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is 1-N'-[2-fluoro-5-(trifluoromethyl)phenyl]-1-N'-(4-hydroxyphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-fluoro-5-(trifluoromethyl)phenyl]-1-N'-(4-hydroxyphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 174915783 |
| Molecular Formula | C18H14F4N2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-N'-[2-fluoro-5-(trifluoromethyl)phenyl]-1-N'-(4-hydroxyphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(c2ccc(O)cc2)c2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C18H14F4N2O3/c19-13-6-1-10(18(20,21)22)9-14(13)24(11-2-4-12(25)5-3-11)16(27)17(7-8-17)15(23)26/h1-6,9,25H,7-8H2,(H2,23,26) |
| InChIKey | BZTHSNJMFANAIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|