C21H14FN5O — CID 86293530
N-[3-[2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-4-fluorobenzamide (PubChem CID 86293530) has the molecular formula C21H14FN5O and a molecular weight of 371.38 g/mol. Its IUPAC name is N-[3-[2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 86293530 |
| Molecular Formula | C21H14FN5O |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[3-[2-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)ethynyl]phenyl]-4-fluorobenzamide |
| SMILES | Nc1ncnc2[nH]cc(C#Cc3cccc(NC(=O)c4ccc(F)cc4)c3)c12 |
| InChI | InChI=1S/C21H14FN5O/c22-16-8-6-14(7-9-16)21(28)27-17-3-1-2-13(10-17)4-5-15-11-24-20-18(15)19(23)25-12-26-20/h1-3,6-12H,(H,27,28)(H3,23,24,25,26) |
| InChIKey | QUQHXGFZHZKLNN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|